C25H19F3N4O6 — CID 126227894
[2-nitro-6-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126227894) has the molecular formula C25H19F3N4O6 and a molecular weight of 528.44 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-nitro-6-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126227894 |
| Molecular Formula | C25H19F3N4O6 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [2-nitro-6-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)N/N=C/c2cccc([N+](=O)[O-])c2OC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H19F3N4O6/c1-2-21(33)30-19-11-9-15(10-12-19)23(34)31-29-14-17-6-4-8-20(32(36)37)22(17)38-24(35)16-5-3-7-18(13-16)25(26,27)28/h3-14H,2H2,1H3,(H,30,33)(H,31,34)/b29-14+ |
| InChIKey | AALOUBSHBPKLCN-IPPBACCNSA-N |
| XLogP | 4.95 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|