C39H31N3O7 — CID 126018308
[2-[(E)-3-oxo-3-[2-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] 4-methoxybenzoate (PubChem CID 126018308) has the molecular formula C39H31N3O7 and a molecular weight of 653.69 g/mol. Its IUPAC name is [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126018308 |
| Molecular Formula | C39H31N3O7 |
| Molecular Weight | 653.69 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | [2-[(E)-3-oxo-3-[2-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]prop-1-enyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2/C=C/C(=O)Oc2ccccc2/C=N/NC(=O)c2ccc(NC(=O)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H31N3O7/c1-47-33-22-17-30(18-23-33)39(46)49-34-13-7-5-11-28(34)19-24-37(44)48-35-14-8-6-12-31(35)26-40-42-38(45)29-15-20-32(21-16-29)41-36(43)25-27-9-3-2-4-10-27/h2-24,26H,25H2,1H3,(H,41,43)(H,42,45)/b24-19+,40-26+ |
| InChIKey | HHZYGOAUNCOKQG-YJWXGOSUSA-N |
| XLogP | 6.48 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|