C31H23ClN2O5 — CID 3864281
[2-[3-[2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3-methylbenzoate (PubChem CID 3864281) has the molecular formula C31H23ClN2O5 and a molecular weight of 538.99 g/mol. Its IUPAC name is [2-[3-[2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3-methylbenzoate.
| Compound Name | [2-[3-[2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3864281 |
| Molecular Formula | C31H23ClN2O5 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | [2-[3-[2-[[(4-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccccc2C=CC(=O)Oc2ccccc2C=NNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C31H23ClN2O5/c1-21-7-6-10-24(19-21)31(37)39-27-11-4-2-8-22(27)15-18-29(35)38-28-12-5-3-9-25(28)20-33-34-30(36)23-13-16-26(32)17-14-23/h2-20H,1H3,(H,34,36) |
| InChIKey | FZZRLCLMBMYSTN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|