C30H19Cl2N3O7 — CID 126013446
[2-[(E)-3-[2-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126013446) has the molecular formula C30H19Cl2N3O7 and a molecular weight of 604.40 g/mol. Its IUPAC name is [2-[(E)-3-[2-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[(E)-3-[2-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126013446 |
| Molecular Formula | C30H19Cl2N3O7 |
| Molecular Weight | 604.40 g/mol |
| Exact Mass | 603.06 |
| IUPAC Name | [2-[(E)-3-[2-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(/C=C/c1ccccc1OC(=O)c1ccc(Cl)cc1Cl)Oc1ccccc1/C=N/NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H19Cl2N3O7/c31-22-12-15-24(25(32)17-22)30(38)42-26-7-3-1-5-19(26)11-16-28(36)41-27-8-4-2-6-21(27)18-33-34-29(37)20-9-13-23(14-10-20)35(39)40/h1-18H,(H,34,37)/b16-11+,33-18+ |
| InChIKey | QXTAYRYCMKLXCC-ZPQASTMASA-N |
| XLogP | 6.50 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|