C24H18Cl2N4O6 — CID 126225064
[4-nitro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126225064) has the molecular formula C24H18Cl2N4O6 and a molecular weight of 529.34 g/mol. Its IUPAC name is [4-nitro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-nitro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126225064 |
| Molecular Formula | C24H18Cl2N4O6 |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | [4-nitro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2OC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H18Cl2N4O6/c1-2-22(31)28-17-6-3-14(4-7-17)23(32)29-27-13-15-11-18(30(34)35)8-10-21(15)36-24(33)19-9-5-16(25)12-20(19)26/h3-13H,2H2,1H3,(H,28,31)(H,29,32)/b27-13+ |
| InChIKey | HWXSYHJDWBZZQU-UVHMKAGCSA-N |
| XLogP | 5.23 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|