C26H17ClN4O7 — CID 126223494
[2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] furan-2-carboxylate (PubChem CID 126223494) has the molecular formula C26H17ClN4O7 and a molecular weight of 532.90 g/mol. Its IUPAC name is [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] furan-2-carboxylate.
| Compound Name | [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126223494 |
| Molecular Formula | C26H17ClN4O7 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] furan-2-carboxylate |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1OC(=O)c1ccco1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H17ClN4O7/c27-19-7-3-16(4-8-19)24(32)29-20-9-5-17(6-10-20)25(33)30-28-15-18-14-21(31(35)36)11-12-22(18)38-26(34)23-2-1-13-37-23/h1-15H,(H,29,32)(H,30,33)/b28-15+ |
| InChIKey | BCWJCCJICHLSOE-RWPZCVJISA-N |
| XLogP | 5.08 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|