C30H21ClN4O6 — CID 126230030
[2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126230030) has the molecular formula C30H21ClN4O6 and a molecular weight of 568.97 g/mol. Its IUPAC name is [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126230030 |
| Molecular Formula | C30H21ClN4O6 |
| Molecular Weight | 568.97 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | [2-[(E)-[[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H21ClN4O6/c31-24-11-7-21(8-12-24)29(37)33-25-13-9-22(10-14-25)30(38)34-32-19-23-18-26(35(39)40)15-16-27(23)41-28(36)17-6-20-4-2-1-3-5-20/h1-19H,(H,33,37)(H,34,38)/b17-6+,32-19+ |
| InChIKey | ITRCAUNCGWLIMJ-IQRALLOGSA-N |
| XLogP | 5.88 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.97 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|