C26H21ClN4O6 — CID 126225272
[4-chloro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126225272) has the molecular formula C26H21ClN4O6 and a molecular weight of 520.93 g/mol. Its IUPAC name is [4-chloro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-chloro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126225272 |
| Molecular Formula | C26H21ClN4O6 |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | [4-chloro-2-[(E)-[[4-(propanoylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H21ClN4O6/c1-2-24(32)29-21-10-7-18(8-11-21)26(34)30-28-16-19-15-20(27)9-12-23(19)37-25(33)13-6-17-4-3-5-22(14-17)31(35)36/h3-16H,2H2,1H3,(H,29,32)(H,30,34)/b13-6+,28-16+ |
| InChIKey | MXRCVKMJUIZQNE-AZXJJGQMSA-N |
| XLogP | 4.98 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|