C27H18N4O7 — CID 126224631
[2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]-4-nitrophenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126224631) has the molecular formula C27H18N4O7 and a molecular weight of 510.46 g/mol. Its IUPAC name is [2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]-4-nitrophenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]-4-nitrophenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126224631 |
| Molecular Formula | C27H18N4O7 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | [2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]-4-nitrophenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Oc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H18N4O7/c32-26(14-11-18-5-3-8-21(15-18)30(34)35)38-25-13-12-22(31(36)37)16-20(25)17-28-29-27(33)24-10-4-7-19-6-1-2-9-23(19)24/h1-17H,(H,29,33)/b14-11+,28-17+ |
| InChIKey | FGPHIWNBYWSYGE-XKUSBHSNSA-N |
| XLogP | 5.04 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|