C30H21BrClN3O4 — CID 126232415
[2-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126232415) has the molecular formula C30H21BrClN3O4 and a molecular weight of 602.87 g/mol. Its IUPAC name is [2-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126232415 |
| Molecular Formula | C30H21BrClN3O4 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | [2-[[[3-[(4-bromobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1ccccc1C=NNC(=O)c1cccc(NC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C30H21BrClN3O4/c31-24-13-11-21(12-14-24)29(37)34-26-6-3-5-22(18-26)30(38)35-33-19-23-4-1-2-7-27(23)39-28(36)17-10-20-8-15-25(32)16-9-20/h1-19H,(H,34,37)(H,35,38)/b17-10+,33-19? |
| InChIKey | PWIRRVNOUDOALO-BBEODDCXSA-N |
| XLogP | 6.74 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|