C28H20ClN3O5 — CID 126228371
[2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126228371) has the molecular formula C28H20ClN3O5 and a molecular weight of 513.94 g/mol. Its IUPAC name is [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126228371 |
| Molecular Formula | C28H20ClN3O5 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1ccccc1C=NNC(=O)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C28H20ClN3O5/c29-22-13-10-19(11-14-22)12-15-26(33)37-24-8-2-1-5-21(24)18-30-32-27(34)20-6-3-7-23(17-20)31-28(35)25-9-4-16-36-25/h1-18H,(H,31,35)(H,32,34)/b15-12+,30-18? |
| InChIKey | CAUKVJSUQUZUFH-CKFHYBGASA-N |
| XLogP | 5.57 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|