C32H25Cl2N3O6 — CID 126225417
[4-[[[3-[(5-chloro-2-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126225417) has the molecular formula C32H25Cl2N3O6 and a molecular weight of 618.47 g/mol. Its IUPAC name is [4-[[[3-[(5-chloro-2-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[[[3-[(5-chloro-2-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126225417 |
| Molecular Formula | C32H25Cl2N3O6 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | [4-[[[3-[(5-chloro-2-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(C=NNC(=O)c2cccc(NC(=O)c3cc(Cl)ccc3OC)c2)ccc1OC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H25Cl2N3O6/c1-41-27-14-12-24(34)18-26(27)32(40)36-25-5-3-4-22(17-25)31(39)37-35-19-21-8-13-28(29(16-21)42-2)43-30(38)15-9-20-6-10-23(33)11-7-20/h3-19H,1-2H3,(H,36,40)(H,37,39)/b15-9+,35-19? |
| InChIKey | OLYPELQJDLUXNI-CIXMRZNASA-N |
| XLogP | 6.65 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|