C33H26ClN3O7 — CID 126232270
[4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126232270) has the molecular formula C33H26ClN3O7 and a molecular weight of 612.04 g/mol. Its IUPAC name is [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126232270 |
| Molecular Formula | C33H26ClN3O7 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | [4-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc4c(c3)OCO4)c2)ccc1OC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H26ClN3O7/c1-2-41-29-16-22(8-13-28(29)44-31(38)15-9-21-6-11-25(34)12-7-21)19-35-37-33(40)23-4-3-5-26(17-23)36-32(39)24-10-14-27-30(18-24)43-20-42-27/h3-19H,2,20H2,1H3,(H,36,39)(H,37,40)/b15-9+,35-19? |
| InChIKey | RWDNXGMMJQLEQK-CIXMRZNASA-N |
| XLogP | 6.10 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|