C33H28ClN3O7 — CID 126232569
[2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126232569) has the molecular formula C33H28ClN3O7 and a molecular weight of 614.05 g/mol. Its IUPAC name is [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126232569 |
| Molecular Formula | C33H28ClN3O7 |
| Molecular Weight | 614.05 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NN=Cc3ccccc3OC(=O)/C=C/c3ccc(Cl)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H28ClN3O7/c1-41-28-18-24(19-29(42-2)31(28)43-3)32(39)36-26-9-6-8-22(17-26)33(40)37-35-20-23-7-4-5-10-27(23)44-30(38)16-13-21-11-14-25(34)15-12-21/h4-20H,1-3H3,(H,36,39)(H,37,40)/b16-13+,35-20? |
| InChIKey | VNHGWIGGQBUTSJ-NTLWSFFRSA-N |
| XLogP | 6.00 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.05 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|