C29H25N3O8 — CID 126231520
[2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126231520) has the molecular formula C29H25N3O8 and a molecular weight of 543.53 g/mol. Its IUPAC name is [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126231520 |
| Molecular Formula | C29H25N3O8 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | [2-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NN=Cc3ccccc3OC(=O)c3ccco3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H25N3O8/c1-36-24-15-20(16-25(37-2)26(24)38-3)27(33)31-21-10-6-9-18(14-21)28(34)32-30-17-19-8-4-5-11-22(19)40-29(35)23-12-7-13-39-23/h4-17H,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | OGTJWXUXBWCIRH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|