C27H19N3O7 — CID 126231540
[2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126231540) has the molecular formula C27H19N3O7 and a molecular weight of 497.46 g/mol. Its IUPAC name is [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126231540 |
| Molecular Formula | C27H19N3O7 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [2-[[[3-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(NN=Cc1ccccc1OC(=O)c1ccc2c(c1)OCO2)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C27H19N3O7/c31-25(17-6-3-7-20(13-17)29-26(32)23-9-4-12-34-23)30-28-15-19-5-1-2-8-21(19)37-27(33)18-10-11-22-24(14-18)36-16-35-22/h1-15H,16H2,(H,29,32)(H,30,31) |
| InChIKey | MZYKCPCCWXMNLL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|