C29H21N3O6 — CID 126225246
[2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126225246) has the molecular formula C29H21N3O6 and a molecular weight of 507.50 g/mol. Its IUPAC name is [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126225246 |
| Molecular Formula | C29H21N3O6 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(NN=Cc1ccccc1OC(=O)c1ccccc1)c1cccc(NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C29H21N3O6/c33-27(21-13-14-25-26(16-21)37-18-36-25)31-23-11-6-10-20(15-23)28(34)32-30-17-22-9-4-5-12-24(22)38-29(35)19-7-2-1-3-8-19/h1-17H,18H2,(H,31,33)(H,32,34) |
| InChIKey | MSEHBNNXZGOOSY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|