C20H15N3O6 — CID 9273872
N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9273872) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9273872 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H15N3O6/c24-18(22-23-19(25)13-5-8-15-17(10-13)29-11-28-15)12-3-6-14(7-4-12)21-20(26)16-2-1-9-27-16/h1-10H,11H2,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | FOPSVLORJMERJT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|