C29H25N3O7 — CID 126223416
[2-ethoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126223416) has the molecular formula C29H25N3O7 and a molecular weight of 527.53 g/mol. Its IUPAC name is [2-ethoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-ethoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126223416 |
| Molecular Formula | C29H25N3O7 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | [2-ethoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc(NC(=O)c3cccc(OC)c3)c2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C29H25N3O7/c1-3-37-26-15-19(12-13-24(26)39-29(35)25-11-6-14-38-25)18-30-32-28(34)20-7-4-9-22(16-20)31-27(33)21-8-5-10-23(17-21)36-2/h4-18H,3H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | AKQMVUZPKYNYDR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|