C23H21N3O7 — CID 4660927
[4-[[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 4660927) has the molecular formula C23H21N3O7 and a molecular weight of 451.44 g/mol. Its IUPAC name is [4-[[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 4660927 |
| Molecular Formula | C23H21N3O7 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [4-[[[2-(furan-2-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=NNC(=O)CNC(=O)c3ccco3)cc2OC)c1 |
| InChI | InChI=1S/C23H21N3O7/c1-30-17-6-3-5-16(12-17)23(29)33-18-9-8-15(11-20(18)31-2)13-25-26-21(27)14-24-22(28)19-7-4-10-32-19/h3-13H,14H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | DLVXLVSQPUNXOY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|