C35H32N4O10 — CID 126231913
[2-ethoxy-4-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126231913) has the molecular formula C35H32N4O10 and a molecular weight of 668.66 g/mol. Its IUPAC name is [2-ethoxy-4-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-ethoxy-4-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126231913 |
| Molecular Formula | C35H32N4O10 |
| Molecular Weight | 668.66 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | [2-ethoxy-4-[[[3-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)c2)ccc1OC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H32N4O10/c1-5-48-29-17-23(12-14-28(29)49-32(40)15-13-22-8-6-11-27(16-22)39(43)44)21-36-38-35(42)24-9-7-10-26(18-24)37-34(41)25-19-30(45-2)33(47-4)31(20-25)46-3/h6-21H,5H2,1-4H3,(H,37,41)(H,38,42)/b15-13+,36-21? |
| InChIKey | OGROJOMVRSODDL-STPVQZFWSA-N |
| XLogP | 5.65 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|