C26H21N3O7 — CID 126131007
[4-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126131007) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is [4-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126131007 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [4-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)COC3)ccc1OC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21N3O7/c1-34-24-12-18(14-27-28-26(31)19-7-8-20-15-35-16-21(20)13-19)5-9-23(24)36-25(30)10-6-17-3-2-4-22(11-17)29(32)33/h2-14H,15-16H2,1H3,(H,28,31)/b10-6+,27-14? |
| InChIKey | BJKGZRLIKGCFGN-DGNXGQHVSA-N |
| XLogP | 4.02 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|