C32H27ClN4O10 — CID 126231119
[4-nitro-2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126231119) has the molecular formula C32H27ClN4O10 and a molecular weight of 663.04 g/mol. Its IUPAC name is [4-nitro-2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [4-nitro-2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126231119 |
| Molecular Formula | C32H27ClN4O10 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | [4-nitro-2-[(E)-[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)c1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H27ClN4O10/c1-43-26-11-7-21(33)16-24(26)32(40)47-25-12-10-23(37(41)42)13-20(25)17-34-36-31(39)18-5-8-22(9-6-18)35-30(38)19-14-27(44-2)29(46-4)28(15-19)45-3/h5-17H,1-4H3,(H,35,38)(H,36,39)/b34-17+ |
| InChIKey | NSHMZIOQFXEKPI-KVAAJVFYSA-N |
| XLogP | 5.52 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|