C38H27Cl2N3O6 — CID 126021266
[2-[(E)-3-[2-[(E)-[[4-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126021266) has the molecular formula C38H27Cl2N3O6 and a molecular weight of 692.56 g/mol. Its IUPAC name is [2-[(E)-3-[2-[(E)-[[4-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[(E)-3-[2-[(E)-[[4-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126021266 |
| Molecular Formula | C38H27Cl2N3O6 |
| Molecular Weight | 692.56 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | [2-[(E)-3-[2-[(E)-[[4-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenoxy]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)N/N=C/c3ccccc3OC(=O)/C=C/c3ccccc3OC(=O)c3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C38H27Cl2N3O6/c1-24-7-6-10-27(21-24)36(45)42-30-17-13-26(14-18-30)37(46)43-41-23-28-9-3-5-12-34(28)48-35(44)20-15-25-8-2-4-11-33(25)49-38(47)31-19-16-29(39)22-32(31)40/h2-23H,1H3,(H,42,45)(H,43,46)/b20-15+,41-23+ |
| InChIKey | XYTKMFLFRRSPTJ-XNULVYCZSA-N |
| XLogP | 8.16 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.56 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|