C33H27N3O5 — CID 126040445
[2-[(E)-3-oxo-3-[2-[4-[(2-phenylacetyl)amino]benzoyl]hydrazinyl]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126040445) has the molecular formula C33H27N3O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is [2-[(E)-3-oxo-3-[2-[4-[(2-phenylacetyl)amino]benzoyl]hydrazinyl]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(E)-3-oxo-3-[2-[4-[(2-phenylacetyl)amino]benzoyl]hydrazinyl]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126040445 |
| Molecular Formula | C33H27N3O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [2-[(E)-3-oxo-3-[2-[4-[(2-phenylacetyl)amino]benzoyl]hydrazinyl]prop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1OC(=O)/C=C/c1ccccc1)NNC(=O)c1ccc(NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H27N3O5/c37-30(21-18-26-13-7-8-14-29(26)41-32(39)22-15-24-9-3-1-4-10-24)35-36-33(40)27-16-19-28(20-17-27)34-31(38)23-25-11-5-2-6-12-25/h1-22H,23H2,(H,34,38)(H,35,37)(H,36,40)/b21-18+,22-15+ |
| InChIKey | MXNXDYQWWHNMGE-CYBKKEAASA-N |
| XLogP | 4.96 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|