C29H22N2O4 — CID 126043197
[2-[(E)-3-[2-(naphthalene-1-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126043197) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is [2-[(E)-3-[2-(naphthalene-1-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[(E)-3-[2-(naphthalene-1-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126043197 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [2-[(E)-3-[2-(naphthalene-1-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1OC(=O)/C=C/c1ccccc1)NNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H22N2O4/c32-27(30-31-29(34)25-15-8-13-22-11-4-6-14-24(22)25)19-18-23-12-5-7-16-26(23)35-28(33)20-17-21-9-2-1-3-10-21/h1-20H,(H,30,32)(H,31,34)/b19-18+,20-17+ |
| InChIKey | BHRFPXVJTLLJGB-LKRWSQIDSA-N |
| XLogP | 4.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|