C21H12Cl2N4O7 — CID 126233402
[2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 4-nitrobenzoate (PubChem CID 126233402) has the molecular formula C21H12Cl2N4O7 and a molecular weight of 503.25 g/mol. Its IUPAC name is [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 4-nitrobenzoate.
| Compound Name | [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126233402 |
| Molecular Formula | C21H12Cl2N4O7 |
| Molecular Weight | 503.25 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1c(/C=N/NC(=O)c2ccc(Cl)cc2Cl)cccc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H12Cl2N4O7/c22-14-6-9-16(17(23)10-14)20(28)25-24-11-13-2-1-3-18(27(32)33)19(13)34-21(29)12-4-7-15(8-5-12)26(30)31/h1-11H,(H,25,28)/b24-11+ |
| InChIKey | UIUCYMBJJNJHLK-BHGWPJFGSA-N |
| XLogP | 4.79 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|