C14H8Cl3N3O3 — CID 4507805
2,4-dichloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]benzamide (PubChem CID 4507805) has the molecular formula C14H8Cl3N3O3 and a molecular weight of 372.60 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4507805 |
| Molecular Formula | C14H8Cl3N3O3 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 2,4-dichloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])ccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl3N3O3/c15-9-1-3-11(13(17)6-9)14(21)19-18-7-8-5-10(20(22)23)2-4-12(8)16/h1-7H,(H,19,21) |
| InChIKey | JEFXQAHVTUUVMG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|