C30H19Cl2N5O3S — CID 126117727
2,4-dichloro-N-[(E)-[2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-5-nitrophenyl]methylideneamino]benzamide (PubChem CID 126117727) has the molecular formula C30H19Cl2N5O3S and a molecular weight of 600.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[(E)-[2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-5-nitrophenyl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(E)-[2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-5-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126117727 |
| Molecular Formula | C30H19Cl2N5O3S |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | 2,4-dichloro-N-[(E)-[2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-5-nitrophenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1Sc1nc(-c2ccccc2)cc(-c2ccccc2)n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H19Cl2N5O3S/c31-22-11-13-24(25(32)16-22)29(38)36-33-18-21-15-23(37(39)40)12-14-28(21)41-30-34-26(19-7-3-1-4-8-19)17-27(35-30)20-9-5-2-6-10-20/h1-18H,(H,36,38)/b33-18+ |
| InChIKey | CMBQDMYCXOTEIH-DPNNOFEESA-N |
| XLogP | 7.94 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|