C24H17N5O3 — CID 4230749
N-[(4-nitrophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide (PubChem CID 4230749) has the molecular formula C24H17N5O3 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide.
| Compound Name | N-[(4-nitrophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 4230749 |
| Molecular Formula | C24H17N5O3 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[(4-nitrophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H17N5O3/c30-24(28-25-16-17-11-13-20(14-12-17)29(31)32)23-26-21(18-7-3-1-4-8-18)15-22(27-23)19-9-5-2-6-10-19/h1-16H,(H,28,30) |
| InChIKey | ONNFDHOYNBLMPN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|