C10H8N6O3 — CID 135414804
N-(benzylideneamino)-5-nitro-1H-1,2,4-triazole-3-carboxamide (PubChem CID 135414804) has the molecular formula C10H8N6O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is N-(benzylideneamino)-5-nitro-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(benzylideneamino)-5-nitro-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135414804 |
| Molecular Formula | C10H8N6O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-(benzylideneamino)-5-nitro-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1)c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H8N6O3/c17-9(8-12-10(15-13-8)16(18)19)14-11-6-7-4-2-1-3-5-7/h1-6H,(H,14,17)(H,12,13,15) |
| InChIKey | OOCQWAMAFVBPQC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|