C11H9N5O3 — CID 909702
N-(benzylideneamino)-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 909702) has the molecular formula C11H9N5O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-(benzylideneamino)-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-(benzylideneamino)-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 909702 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-(benzylideneamino)-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9N5O3/c17-11(10-9(16(18)19)7-13-14-10)15-12-6-8-4-2-1-3-5-8/h1-7H,(H,13,14)(H,15,17) |
| InChIKey | RTXNWPOHNGDHJH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|