C11H8BrN5O3 — CID 5411707
4-bromo-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 5411707) has the molecular formula C11H8BrN5O3 and a molecular weight of 338.12 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5411707 |
| Molecular Formula | C11H8BrN5O3 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 4-bromo-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1cccc([N+](=O)[O-])c1)c1[nH]ncc1Br |
| InChI | InChI=1S/C11H8BrN5O3/c12-9-6-14-15-10(9)11(18)16-13-5-7-2-1-3-8(4-7)17(19)20/h1-6H,(H,14,15)(H,16,18)/b13-5- |
| InChIKey | KKRVPIIJILWIMA-ACAGNQJTSA-N |
| XLogP | 1.84 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|