C12H10BrN5O3 — CID 5499600
4-bromo-1-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 5499600) has the molecular formula C12H10BrN5O3 and a molecular weight of 352.15 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5499600 |
| Molecular Formula | C12H10BrN5O3 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-bromo-1-methyl-N-[(Z)-(3-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cn1cc(Br)c(C(=O)N/N=C\c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H10BrN5O3/c1-17-7-10(13)11(16-17)12(19)15-14-6-8-3-2-4-9(5-8)18(20)21/h2-7H,1H3,(H,15,19)/b14-6- |
| InChIKey | BMOGRZBEKLYYPV-NSIKDUERSA-N |
| XLogP | 1.85 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|