C10H8N6O3S — CID 6059446
5-amino-N-[(Z)-(3-nitrophenyl)methylideneamino]thiadiazole-4-carboxamide (PubChem CID 6059446) has the molecular formula C10H8N6O3S and a molecular weight of 292.28 g/mol. Its IUPAC name is 5-amino-N-[(Z)-(3-nitrophenyl)methylideneamino]thiadiazole-4-carboxamide.
| Compound Name | 5-amino-N-[(Z)-(3-nitrophenyl)methylideneamino]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 6059446 |
| Molecular Formula | C10H8N6O3S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-amino-N-[(Z)-(3-nitrophenyl)methylideneamino]thiadiazole-4-carboxamide |
| SMILES | Nc1snnc1C(=O)N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8N6O3S/c11-9-8(13-15-20-9)10(17)14-12-5-6-2-1-3-7(4-6)16(18)19/h1-5H,11H2,(H,14,17)/b12-5- |
| InChIKey | GEWRGRAYSUYILG-XGICHPGQSA-N |
| XLogP | 0.79 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|