C22H18N8O6 — CID 39844328
3-amino-N-[(E)-[3-[(Z)-[(3-amino-5-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]-5-nitrobenzamide (PubChem CID 39844328) has the molecular formula C22H18N8O6 and a molecular weight of 490.44 g/mol. Its IUPAC name is 3-amino-N-[(E)-[3-[(Z)-[(3-amino-5-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]-5-nitrobenzamide.
| Compound Name | 3-amino-N-[(E)-[3-[(Z)-[(3-amino-5-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 39844328 |
| Molecular Formula | C22H18N8O6 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-amino-N-[(E)-[3-[(Z)-[(3-amino-5-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]-5-nitrobenzamide |
| SMILES | Nc1cc(C(=O)N/N=C\c2cccc(/C=N/NC(=O)c3cc(N)cc([N+](=O)[O-])c3)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N8O6/c23-17-5-15(7-19(9-17)29(33)34)21(31)27-25-11-13-2-1-3-14(4-13)12-26-28-22(32)16-6-18(24)10-20(8-16)30(35)36/h1-12H,23-24H2,(H,27,31)(H,28,32)/b25-11-,26-12+ |
| InChIKey | LZLPMPYIRJRSAN-UIXGLJBASA-N |
| XLogP | 2.20 |
| TPSA | 221.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|