C20H14N4O6 — CID 171135969
3,5-dinitro-N-[(3-phenoxyphenyl)methylideneamino]benzamide (PubChem CID 171135969) has the molecular formula C20H14N4O6 and a molecular weight of 406.35 g/mol. Its IUPAC name is 3,5-dinitro-N-[(3-phenoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dinitro-N-[(3-phenoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 171135969 |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3,5-dinitro-N-[(3-phenoxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cccc(Oc2ccccc2)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14N4O6/c25-20(15-10-16(23(26)27)12-17(11-15)24(28)29)22-21-13-14-5-4-8-19(9-14)30-18-6-2-1-3-7-18/h1-13H,(H,22,25) |
| InChIKey | GOIOMDHQWJJQDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|