C20H13BrN4O6 — CID 2250273
4-bromo-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]benzamide (PubChem CID 2250273) has the molecular formula C20H13BrN4O6 and a molecular weight of 485.25 g/mol. Its IUPAC name is 4-bromo-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2250273 |
| Molecular Formula | C20H13BrN4O6 |
| Molecular Weight | 485.25 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 4-bromo-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H13BrN4O6/c21-15-6-4-14(5-7-15)20(26)23-22-12-13-2-1-3-17(10-13)31-19-9-8-16(24(27)28)11-18(19)25(29)30/h1-12H,(H,23,26) |
| InChIKey | CQLNCAGBDMMISG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|