C21H15ClN4O6 — CID 41339746
2-chloro-N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methylbenzamide (PubChem CID 41339746) has the molecular formula C21H15ClN4O6 and a molecular weight of 454.83 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 41339746 |
| Molecular Formula | C21H15ClN4O6 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-chloro-N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C\c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClN4O6/c1-13-5-7-17(18(22)9-13)21(27)24-23-12-14-3-2-4-16(10-14)32-20-8-6-15(25(28)29)11-19(20)26(30)31/h2-12H,1H3,(H,24,27)/b23-12- |
| InChIKey | KGTFOXWLYVGEAF-FMCGGJTJSA-N |
| XLogP | 5.02 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|