C21H16N4O8 — CID 126396318
N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126396318) has the molecular formula C21H16N4O8 and a molecular weight of 452.38 g/mol. Its IUPAC name is N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126396318 |
| Molecular Formula | C21H16N4O8 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c(O)c1 |
| InChI | InChI=1S/C21H16N4O8/c1-32-16-7-8-17(19(26)11-16)21(27)23-22-12-13-2-5-15(6-3-13)33-20-9-4-14(24(28)29)10-18(20)25(30)31/h2-12,26H,1H3,(H,23,27)/b22-12- |
| InChIKey | LGSYXESXESDSNS-UUYOSTAYSA-N |
| XLogP | 3.77 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|