C23H20N4O6 — CID 99944561
2-(2,4-dimethylphenyl)-N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide (PubChem CID 99944561) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99944561 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C23H20N4O6/c1-15-3-6-18(16(2)11-15)12-23(28)25-24-14-17-4-8-20(9-5-17)33-22-10-7-19(26(29)30)13-21(22)27(31)32/h3-11,13-14H,12H2,1-2H3,(H,25,28)/b24-14+ |
| InChIKey | HLMKJBVEYJYYLX-ZVHZXABRSA-N |
| XLogP | 4.60 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|