C24H20N4O8 — CID 126317827
N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126317827) has the molecular formula C24H20N4O8 and a molecular weight of 492.44 g/mol. Its IUPAC name is N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126317827 |
| Molecular Formula | C24H20N4O8 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C24H20N4O8/c1-3-12-35-22-10-6-17(13-23(22)34-2)24(29)26-25-15-16-4-8-19(9-5-16)36-21-11-7-18(27(30)31)14-20(21)28(32)33/h3-11,13-15H,1,12H2,2H3,(H,26,29)/b25-15+ |
| InChIKey | HCVPLFTYBYYFOE-MFKUBSTISA-N |
| XLogP | 4.63 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|