C28H22N4O8 — CID 126320693
N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126320693) has the molecular formula C28H22N4O8 and a molecular weight of 542.50 g/mol. Its IUPAC name is N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126320693 |
| Molecular Formula | C28H22N4O8 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | N-[(E)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H22N4O8/c1-38-27-15-21(9-13-26(27)39-18-20-5-3-2-4-6-20)28(33)30-29-17-19-7-11-23(12-8-19)40-25-14-10-22(31(34)35)16-24(25)32(36)37/h2-17H,18H2,1H3,(H,30,33)/b29-17+ |
| InChIKey | RVJMTSMXRIZIRP-STBIYBPSSA-N |
| XLogP | 5.65 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|