C27H24F3N3O7 — CID 126328991
3-ethoxy-N-[(E)-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide (PubChem CID 126328991) has the molecular formula C27H24F3N3O7 and a molecular weight of 559.50 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126328991 |
| Molecular Formula | C27H24F3N3O7 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 3-ethoxy-N-[(E)-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H24F3N3O7/c1-4-12-39-22-10-7-18(14-25(22)38-5-2)26(34)32-31-16-17-6-9-23(24(13-17)37-3)40-21-11-8-19(27(28,29)30)15-20(21)33(35)36/h4,6-11,13-16H,1,5,12H2,2-3H3,(H,32,34)/b31-16+ |
| InChIKey | LHDWKTKLEUPBEP-WCMJOSRZSA-N |
| XLogP | 6.14 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|