C31H25BrF3N3O7 — CID 126334058
N-[(E)-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126334058) has the molecular formula C31H25BrF3N3O7 and a molecular weight of 688.45 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126334058 |
| Molecular Formula | C31H25BrF3N3O7 |
| Molecular Weight | 688.45 g/mol |
| Exact Mass | 687.08 |
| IUPAC Name | N-[(E)-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H25BrF3N3O7/c1-3-43-27-15-21(9-11-26(27)44-18-19-7-5-4-6-8-19)30(39)37-36-17-20-13-23(32)29(28(14-20)42-2)45-25-12-10-22(31(33,34)35)16-24(25)38(40)41/h4-17H,3,18H2,1-2H3,(H,37,39)/b36-17+ |
| InChIKey | XYPDZRMIRAVLIR-KULFSUQXSA-N |
| XLogP | 7.92 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.45 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|