C26H22Br2F3N3O6 — CID 126320899
N-[(E)-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide (PubChem CID 126320899) has the molecular formula C26H22Br2F3N3O6 and a molecular weight of 689.28 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126320899 |
| Molecular Formula | C26H22Br2F3N3O6 |
| Molecular Weight | 689.28 g/mol |
| Exact Mass | 686.98 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Br)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Br)c2)cc1OCC |
| InChI | InChI=1S/C26H22Br2F3N3O6/c1-3-9-39-22-7-5-16(12-23(22)38-4-2)25(35)33-32-14-15-10-18(27)24(19(28)11-15)40-21-8-6-17(26(29,30)31)13-20(21)34(36)37/h5-8,10-14H,3-4,9H2,1-2H3,(H,33,35)/b32-14+ |
| InChIKey | HCJUVJVDGFSZKZ-HIWRWHBISA-N |
| XLogP | 7.88 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.28 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|