C26H24F3N3O6 — CID 126321966
3-ethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-propoxybenzamide (PubChem CID 126321966) has the molecular formula C26H24F3N3O6 and a molecular weight of 531.49 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-propoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 126321966 |
| Molecular Formula | C26H24F3N3O6 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 3-ethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C26H24F3N3O6/c1-3-12-37-23-10-8-18(14-24(23)36-4-2)25(33)31-30-16-17-6-5-7-20(13-17)38-22-11-9-19(26(27,28)29)15-21(22)32(34)35/h5-11,13-16H,3-4,12H2,1-2H3,(H,31,33)/b30-16+ |
| InChIKey | WZQPBBPNKNQDHR-OKCVXOCRSA-N |
| XLogP | 6.36 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|