C23H17ClF3N3O6 — CID 126329491
N-[(E)-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126329491) has the molecular formula C23H17ClF3N3O6 and a molecular weight of 523.85 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126329491 |
| Molecular Formula | C23H17ClF3N3O6 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | N-[(E)-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H17ClF3N3O6/c1-34-20-6-3-13(10-21(20)35-2)22(31)29-28-12-14-9-16(24)5-8-18(14)36-19-7-4-15(23(25,26)27)11-17(19)30(32)33/h3-12H,1-2H3,(H,29,31)/b28-12+ |
| InChIKey | NKLSEERHFZUDNL-KVSWJAHQSA-N |
| XLogP | 5.84 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|