C17H14F3N3O5 — CID 40591844
N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 40591844) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 40591844 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N\NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3N3O5/c1-27-14-8-15(28-2)13(23(25)26)7-11(14)9-21-22-16(24)10-4-3-5-12(6-10)17(18,19)20/h3-9H,1-2H3,(H,22,24)/b21-9- |
| InChIKey | KCPNICAAZSYYQQ-NKVSQWTQSA-N |
| XLogP | 3.39 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|