C15H9BrF3N3O4 — CID 137080586
N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 137080586) has the molecular formula C15H9BrF3N3O4 and a molecular weight of 432.15 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137080586 |
| Molecular Formula | C15H9BrF3N3O4 |
| Molecular Weight | 432.15 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])cc(Br)c1O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9BrF3N3O4/c16-12-6-11(22(25)26)5-9(13(12)23)7-20-21-14(24)8-2-1-3-10(4-8)15(17,18)19/h1-7,23H,(H,21,24)/b20-7- |
| InChIKey | JCBNEXNXZZNXDR-SCDVKCJHSA-N |
| XLogP | 3.85 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|